C22H28ClNO3S — CID 46918839
N-(4-chloro-2-formylphenyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 46918839) has the molecular formula C22H28ClNO3S and a molecular weight of 421.99 g/mol. Its IUPAC name is N-(4-chloro-2-formylphenyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-(4-chloro-2-formylphenyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 46918839 |
| Molecular Formula | C22H28ClNO3S |
| Molecular Weight | 421.99 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-(4-chloro-2-formylphenyl)-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)Nc2ccc(Cl)cc2C=O)c(C(C)C)c1 |
| InChI | InChI=1S/C22H28ClNO3S/c1-13(2)16-10-19(14(3)4)22(20(11-16)15(5)6)28(26,27)24-21-8-7-18(23)9-17(21)12-25/h7-15,24H,1-6H3 |
| InChIKey | YCIRMBFZXOROEN-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.99 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|