C29H36N2O2S — CID 70984488
N-[2-(benzyliminomethyl)phenyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 70984488) has the molecular formula C29H36N2O2S and a molecular weight of 476.69 g/mol. Its IUPAC name is N-[2-(benzyliminomethyl)phenyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-[2-(benzyliminomethyl)phenyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 70984488 |
| Molecular Formula | C29H36N2O2S |
| Molecular Weight | 476.69 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | N-[2-(benzyliminomethyl)phenyl]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)Nc2ccccc2/C=N\Cc2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C29H36N2O2S/c1-20(2)25-16-26(21(3)4)29(27(17-25)22(5)6)34(32,33)31-28-15-11-10-14-24(28)19-30-18-23-12-8-7-9-13-23/h7-17,19-22,31H,18H2,1-6H3/b30-19- |
| InChIKey | YAXFMYWLPZIBGW-FSGOGVSDSA-N |
| XLogP | 7.48 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.69 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|