C28H28N6O4S2 — CID 101033192
4-amino-N-[2-[2-[[2-[(4-aminophenyl)sulfonylamino]phenyl]methylideneamino]ethyliminomethyl]phenyl]benzenesulfonamide (PubChem CID 101033192) has the molecular formula C28H28N6O4S2 and a molecular weight of 576.70 g/mol. Its IUPAC name is 4-amino-N-[2-[2-[[2-[(4-aminophenyl)sulfonylamino]phenyl]methylideneamino]ethyliminomethyl]phenyl]benzenesulfonamide.
| Compound Name | 4-amino-N-[2-[2-[[2-[(4-aminophenyl)sulfonylamino]phenyl]methylideneamino]ethyliminomethyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 101033192 |
| Molecular Formula | C28H28N6O4S2 |
| Molecular Weight | 576.70 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 4-amino-N-[2-[2-[[2-[(4-aminophenyl)sulfonylamino]phenyl]methylideneamino]ethyliminomethyl]phenyl]benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)Nc2ccccc2/C=N\CC/N=C/c2ccccc2NS(=O)(=O)c2ccc(N)cc2)cc1 |
| InChI | InChI=1S/C28H28N6O4S2/c29-23-9-13-25(14-10-23)39(35,36)33-27-7-3-1-5-21(27)19-31-17-18-32-20-22-6-2-4-8-28(22)34-40(37,38)26-15-11-24(30)12-16-26/h1-16,19-20,33-34H,17-18,29-30H2/b31-19-,32-20+ |
| InChIKey | CAWODKAAPZOHCE-QXLZFTBOSA-N |
| XLogP | 3.99 |
| TPSA | 169.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.70 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|