C14H14N2O2S — CID 143002799
4-amino-N-(cyclooctatetraenyl)benzenesulfonamide (PubChem CID 143002799) has the molecular formula C14H14N2O2S and a molecular weight of 274.35 g/mol. Its IUPAC name is 4-amino-N-(cyclooctatetraenyl)benzenesulfonamide.
| Compound Name | 4-amino-N-(cyclooctatetraenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 143002799 |
| Molecular Formula | C14H14N2O2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-amino-N-(cyclooctatetraenyl)benzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)NC2=C/C=C\C=C/C=C\2)cc1 |
| InChI | InChI=1S/C14H14N2O2S/c15-12-8-10-14(11-9-12)19(17,18)16-13-6-4-2-1-3-5-7-13/h1-11,16H,15H2/b2-1-,3-1-,4-2-,5-3-,6-4-,7-5-,13-6+,13-7+ |
| InChIKey | SPRKWVPRVDLHEX-VMAXLNEWSA-N |
| XLogP | 2.11 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|