C11H12N4O2S — CID 71312514
4-amino-N-(4-methylpyrimidin-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide (PubChem CID 71312514) has the molecular formula C11H12N4O2S and a molecular weight of 270.26 g/mol. Its IUPAC name is 4-amino-N-(4-methylpyrimidin-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide.
| Compound Name | 4-amino-N-(4-methylpyrimidin-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide |
|---|---|
| PubChem CID | 71312514 |
| Molecular Formula | C11H12N4O2S |
| Molecular Weight | 270.26 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 4-amino-N-(4-methylpyrimidin-2-yl)(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-sulfonamide |
| SMILES | Cc1ccnc(NS(=O)(=O)[13c]2[13cH][13cH][13c](N)[13cH][13cH]2)n1 |
| InChI | InChI=1S/C11H12N4O2S/c1-8-6-7-13-11(14-8)15-18(16,17)10-4-2-9(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15)/i2+1,3+1,4+1,5+1,9+1,10+1 |
| InChIKey | QPPBRPIAZZHUNT-PBZDKDNVSA-N |
| XLogP | 1.17 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.26 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|