C16H20N4O3S — CID 139196182
4-amino-N-(4-methylpyrimidin-2-yl)benzenesulfonamide;cyclopentanone (PubChem CID 139196182) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is 4-amino-N-(4-methylpyrimidin-2-yl)benzenesulfonamide;cyclopentanone.
| Compound Name | 4-amino-N-(4-methylpyrimidin-2-yl)benzenesulfonamide;cyclopentanone |
|---|---|
| PubChem CID | 139196182 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 4-amino-N-(4-methylpyrimidin-2-yl)benzenesulfonamide;cyclopentanone |
| SMILES | Cc1ccnc(NS(=O)(=O)c2ccc(N)cc2)n1.O=C1CCCC1 |
| InChI | InChI=1S/C11H12N4O2S.C5H8O/c1-8-6-7-13-11(14-8)15-18(16,17)10-4-2-9(12)3-5-10;6-5-3-1-2-4-5/h2-7H,12H2,1H3,(H,13,14,15);1-4H2 |
| InChIKey | SANCZWBTFZKJRF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|