C13H16N4O4S2 — CID 19683635
4-(ethylsulfonylamino)-N-(4-methylpyrimidin-2-yl)benzenesulfonamide (PubChem CID 19683635) has the molecular formula C13H16N4O4S2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 4-(ethylsulfonylamino)-N-(4-methylpyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 4-(ethylsulfonylamino)-N-(4-methylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 19683635 |
| Molecular Formula | C13H16N4O4S2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 4-(ethylsulfonylamino)-N-(4-methylpyrimidin-2-yl)benzenesulfonamide |
| SMILES | CCS(=O)(=O)Nc1ccc(S(=O)(=O)Nc2nccc(C)n2)cc1 |
| InChI | InChI=1S/C13H16N4O4S2/c1-3-22(18,19)16-11-4-6-12(7-5-11)23(20,21)17-13-14-9-8-10(2)15-13/h4-9,16H,3H2,1-2H3,(H,14,15,17) |
| InChIKey | GDBLSAKJWCWUMI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |