C19H20N4O3S2 — CID 3315871
4-[[methylidene-(3-methylphenyl)-oxo-lambda6-sulfanyl]amino]-N-(4-methylpyrimidin-2-yl)benzenesulfonamide (PubChem CID 3315871) has the molecular formula C19H20N4O3S2 and a molecular weight of 416.53 g/mol. Its IUPAC name is 4-[[methylidene-(3-methylphenyl)-oxo-lambda6-sulfanyl]amino]-N-(4-methylpyrimidin-2-yl)benzenesulfonamide.
| Compound Name | 4-[[methylidene-(3-methylphenyl)-oxo-lambda6-sulfanyl]amino]-N-(4-methylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3315871 |
| Molecular Formula | C19H20N4O3S2 |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 4-[[methylidene-(3-methylphenyl)-oxo-lambda6-sulfanyl]amino]-N-(4-methylpyrimidin-2-yl)benzenesulfonamide |
| SMILES | C=S(=O)(Nc1ccc(S(=O)(=O)Nc2nccc(C)n2)cc1)c1cccc(C)c1 |
| InChI | InChI=1S/C19H20N4O3S2/c1-14-5-4-6-18(13-14)27(3,24)22-16-7-9-17(10-8-16)28(25,26)23-19-20-12-11-15(2)21-19/h4-13H,3H2,1-2H3,(H,22,24)(H,20,21,23) |
| InChIKey | GKUUFYBITAOZSY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|