C23H31NO2S — CID 71681926
(NE)-N-[(2-methylphenyl)methylidene]-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 71681926) has the molecular formula C23H31NO2S and a molecular weight of 385.57 g/mol. Its IUPAC name is (NE)-N-[(2-methylphenyl)methylidene]-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | (NE)-N-[(2-methylphenyl)methylidene]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 71681926 |
| Molecular Formula | C23H31NO2S |
| Molecular Weight | 385.57 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | (NE)-N-[(2-methylphenyl)methylidene]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | Cc1ccccc1/C=N/S(=O)(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C23H31NO2S/c1-15(2)20-12-21(16(3)4)23(22(13-20)17(5)6)27(25,26)24-14-19-11-9-8-10-18(19)7/h8-17H,1-7H3/b24-14+ |
| InChIKey | NOJCUGDNOGUJIY-ZVHZXABRSA-N |
| XLogP | 6.17 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.57 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|