C26H33NO4S — CID 46863486
methyl (E,2E)-4-phenyl-2-[2,4,6-tri(propan-2-yl)phenyl]sulfonyliminobut-3-enoate (PubChem CID 46863486) has the molecular formula C26H33NO4S and a molecular weight of 455.62 g/mol. Its IUPAC name is methyl (E,2E)-4-phenyl-2-[2,4,6-tri(propan-2-yl)phenyl]sulfonyliminobut-3-enoate.
| Compound Name | methyl (E,2E)-4-phenyl-2-[2,4,6-tri(propan-2-yl)phenyl]sulfonyliminobut-3-enoate |
|---|---|
| PubChem CID | 46863486 |
| Molecular Formula | C26H33NO4S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | methyl (E,2E)-4-phenyl-2-[2,4,6-tri(propan-2-yl)phenyl]sulfonyliminobut-3-enoate |
| SMILES | COC(=O)C(/C=C/c1ccccc1)=N/S(=O)(=O)c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C26H33NO4S/c1-17(2)21-15-22(18(3)4)25(23(16-21)19(5)6)32(29,30)27-24(26(28)31-7)14-13-20-11-9-8-10-12-20/h8-19H,1-7H3/b14-13+,27-24+ |
| InChIKey | SJQXBFDXLVTJKL-SKUDKVKLSA-N |
| XLogP | 6.07 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|