About 3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine
3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine (PubChem CID 70475958) has the molecular formula C20H25NO2
and a molecular weight of 311.43 g/mol. Its IUPAC name is 3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine.
Molecular Properties
| Compound Name | 3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine |
| PubChem CID | 70475958 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine |
| SMILES | CC(C)c1ccc(C(C)N)cc1.O=C(O)C=Cc1ccccc1 |
| InChI | InChI=1S/C11H17N.C9H8O2/c1-8(2)10-4-6-11(7-5-10)9(3)12;10-9(11)7-6-8-4-2-1-3-5-8/h4-9H,12H2,1-3H3;1-7H,(H,10,11) |
| InChIKey | ICMFKHRPUHOAGU-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine?
The IUPAC name of 3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine (CID 70475958) is 3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine.
What is the SMILES notation for 3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine?
The canonical SMILES for 3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine is CC(C)c1ccc(C(C)N)cc1.O=C(O)C=Cc1ccccc1.
What is the InChIKey of 3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine?
The InChIKey is ICMFKHRPUHOAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.C9H8O2/c1-8(2)10-4-6-11(7-5-10)9(3)12;10-9(11)7-6-8-4-2-1-3-5-8/h4-9H,12H2,1-3H3;1-7H,(H,10,11).
What are the key properties of 3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine?
3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine has a molecular weight of 311.43 g/mol, XLogP of 4.61, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylprop-2-enoic acid;1-(4-propan-2-ylphenyl)ethanamine is sourced from PubChem (CID 70475958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).