C24H32 — CID 102406113
2-[(E)-3-phenylprop-2-enyl]-1,3,5-tri(propan-2-yl)benzene (PubChem CID 102406113) has the molecular formula C24H32 and a molecular weight of 320.52 g/mol. Its IUPAC name is 2-[(E)-3-phenylprop-2-enyl]-1,3,5-tri(propan-2-yl)benzene.
| Compound Name | 2-[(E)-3-phenylprop-2-enyl]-1,3,5-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 102406113 |
| Molecular Formula | C24H32 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 2-[(E)-3-phenylprop-2-enyl]-1,3,5-tri(propan-2-yl)benzene |
| SMILES | CC(C)c1cc(C(C)C)c(C/C=C/c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C24H32/c1-17(2)21-15-23(18(3)4)22(24(16-21)19(5)6)14-10-13-20-11-8-7-9-12-20/h7-13,15-19H,14H2,1-6H3/b13-10+ |
| InChIKey | GAGDBLFVHMIUQL-JLHYYAGUSA-N |
| XLogP | 7.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |