C23H30O2S — CID 5382407
2-[(E)-2-phenylethenyl]sulfonyl-1,3,5-tri(propan-2-yl)benzene (PubChem CID 5382407) has the molecular formula C23H30O2S and a molecular weight of 370.56 g/mol. Its IUPAC name is 2-[(E)-2-phenylethenyl]sulfonyl-1,3,5-tri(propan-2-yl)benzene.
| Compound Name | 2-[(E)-2-phenylethenyl]sulfonyl-1,3,5-tri(propan-2-yl)benzene |
|---|---|
| PubChem CID | 5382407 |
| Molecular Formula | C23H30O2S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-[(E)-2-phenylethenyl]sulfonyl-1,3,5-tri(propan-2-yl)benzene |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)/C=C/c2ccccc2)c(C(C)C)c1 |
| InChI | InChI=1S/C23H30O2S/c1-16(2)20-14-21(17(3)4)23(22(15-20)18(5)6)26(24,25)13-12-19-10-8-7-9-11-19/h7-18H,1-6H3/b13-12+ |
| InChIKey | JDCBWDMWRVHKRK-OUKQBFOZSA-N |
| XLogP | 6.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |