C20H26O3S2 — CID 22895692
2-(1-phenylsulfanylethyl)-4,6-di(propan-2-yl)benzenesulfonic acid (PubChem CID 22895692) has the molecular formula C20H26O3S2 and a molecular weight of 378.56 g/mol. Its IUPAC name is 2-(1-phenylsulfanylethyl)-4,6-di(propan-2-yl)benzenesulfonic acid.
| Compound Name | 2-(1-phenylsulfanylethyl)-4,6-di(propan-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 22895692 |
| Molecular Formula | C20H26O3S2 |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-(1-phenylsulfanylethyl)-4,6-di(propan-2-yl)benzenesulfonic acid |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)O)c(C(C)Sc2ccccc2)c1 |
| InChI | InChI=1S/C20H26O3S2/c1-13(2)16-11-18(14(3)4)20(25(21,22)23)19(12-16)15(5)24-17-9-7-6-8-10-17/h6-15H,1-5H3,(H,21,22,23) |
| InChIKey | UDRRNAVNMVUQHQ-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|