About cumene;sulfurochloridic acid
cumene;sulfurochloridic acid (PubChem CID 23037521) has the molecular formula C9H13ClO3S
and a molecular weight of 236.72 g/mol. Its IUPAC name is cumene;sulfurochloridic acid.
Molecular Properties
| Compound Name | cumene;sulfurochloridic acid |
| PubChem CID | 23037521 |
| Molecular Formula | C9H13ClO3S |
| Molecular Weight | 236.72 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | cumene;sulfurochloridic acid |
| SMILES | CC(C)c1ccccc1.O=S(=O)(O)Cl |
| InChI | InChI=1S/C9H12.ClHO3S/c1-8(2)9-6-4-3-5-7-9;1-5(2,3)4/h3-8H,1-2H3;(H,2,3,4) |
| InChIKey | SZEYNNZMJZZWJQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.72 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze cumene;sulfurochloridic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;sulfurochloridic acid?
The IUPAC name of cumene;sulfurochloridic acid (CID 23037521) is cumene;sulfurochloridic acid.
What is the SMILES notation for cumene;sulfurochloridic acid?
The canonical SMILES for cumene;sulfurochloridic acid is CC(C)c1ccccc1.O=S(=O)(O)Cl.
What is the InChIKey of cumene;sulfurochloridic acid?
The InChIKey is SZEYNNZMJZZWJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.ClHO3S/c1-8(2)9-6-4-3-5-7-9;1-5(2,3)4/h3-8H,1-2H3;(H,2,3,4).
What are the key properties of cumene;sulfurochloridic acid?
cumene;sulfurochloridic acid has a molecular weight of 236.72 g/mol, XLogP of 2.84, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;sulfurochloridic acid is sourced from PubChem (CID 23037521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).