acetic acid;cumene

C13H20O4 — CID 172767405

IUPACacetic acid;cumene
SMILESCC(=O)O.CC(=O)O.CC(C)c1ccccc1
InChIInChI=1S/C9H12.2C2H4O2/c1-8(2)9-6-4-3-5-7-9;2*1-2(3)4/h3-8H,1-2H3;2*1H3,(H,3,4)
InChIKeyMMPXCDJCHRTRKF-UHFFFAOYSA-N
MW240.30 g/mol
LogP2.99
Rot. Bonds1

About acetic acid;cumene

acetic acid;cumene (PubChem CID 172767405) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is acetic acid;cumene.

Molecular Properties

Compound Nameacetic acid;cumene
PubChem CID172767405
Molecular FormulaC13H20O4
Molecular Weight240.30 g/mol
Exact Mass240.14
IUPAC Nameacetic acid;cumene
SMILESCC(=O)O.CC(=O)O.CC(C)c1ccccc1
InChIInChI=1S/C9H12.2C2H4O2/c1-8(2)9-6-4-3-5-7-9;2*1-2(3)4/h3-8H,1-2H3;2*1H3,(H,3,4)
InChIKeyMMPXCDJCHRTRKF-UHFFFAOYSA-N
XLogP2.99
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.30
LogP ≤ 52.99
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze acetic acid;cumene with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;cumene?
The IUPAC name of acetic acid;cumene (CID 172767405) is acetic acid;cumene.
What is the SMILES notation for acetic acid;cumene?
The canonical SMILES for acetic acid;cumene is CC(=O)O.CC(=O)O.CC(C)c1ccccc1.
What is the InChIKey of acetic acid;cumene?
The InChIKey is MMPXCDJCHRTRKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.2C2H4O2/c1-8(2)9-6-4-3-5-7-9;2*1-2(3)4/h3-8H,1-2H3;2*1H3,(H,3,4).
What are the key properties of acetic acid;cumene?
acetic acid;cumene has a molecular weight of 240.30 g/mol, XLogP of 2.99, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;cumene is sourced from PubChem (CID 172767405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).