About bis(carbamothioic S-acid);cumene
bis(carbamothioic S-acid);cumene (PubChem CID 87644989) has the molecular formula C11H18N2O2S2
and a molecular weight of 274.41 g/mol. Its IUPAC name is bis(carbamothioic S-acid);cumene.
Molecular Properties
| Compound Name | bis(carbamothioic S-acid);cumene |
| PubChem CID | 87644989 |
| Molecular Formula | C11H18N2O2S2 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | bis(carbamothioic S-acid);cumene |
| SMILES | CC(C)c1ccccc1.NC(=O)S.NC(=O)S |
| InChI | InChI=1S/C9H12.2CH3NOS/c1-8(2)9-6-4-3-5-7-9;2*2-1(3)4/h3-8H,1-2H3;2*(H3,2,3,4) |
| InChIKey | DSFBSQSPNTXNCW-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze bis(carbamothioic S-acid);cumene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(carbamothioic S-acid);cumene?
The IUPAC name of bis(carbamothioic S-acid);cumene (CID 87644989) is bis(carbamothioic S-acid);cumene.
What is the SMILES notation for bis(carbamothioic S-acid);cumene?
The canonical SMILES for bis(carbamothioic S-acid);cumene is CC(C)c1ccccc1.NC(=O)S.NC(=O)S.
What is the InChIKey of bis(carbamothioic S-acid);cumene?
The InChIKey is DSFBSQSPNTXNCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.2CH3NOS/c1-8(2)9-6-4-3-5-7-9;2*2-1(3)4/h3-8H,1-2H3;2*(H3,2,3,4).
What are the key properties of bis(carbamothioic S-acid);cumene?
bis(carbamothioic S-acid);cumene has a molecular weight of 274.41 g/mol, XLogP of 2.80, 1 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(carbamothioic S-acid);cumene is sourced from PubChem (CID 87644989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).