About cumene;N'-methylethanimidamide
cumene;N'-methylethanimidamide (PubChem CID 142863724) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is cumene;N'-methylethanimidamide.
Molecular Properties
| Compound Name | cumene;N'-methylethanimidamide |
| PubChem CID | 142863724 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | cumene;N'-methylethanimidamide |
| SMILES | C/N=C(\C)N.CC(C)c1ccccc1 |
| InChI | InChI=1S/C9H12.C3H8N2/c1-8(2)9-6-4-3-5-7-9;1-3(4)5-2/h3-8H,1-2H3;1-2H3,(H2,4,5) |
| InChIKey | UCYHOCTWVVHIDV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze cumene;N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cumene;N'-methylethanimidamide?
The IUPAC name of cumene;N'-methylethanimidamide (CID 142863724) is cumene;N'-methylethanimidamide.
What is the SMILES notation for cumene;N'-methylethanimidamide?
The canonical SMILES for cumene;N'-methylethanimidamide is C/N=C(\C)N.CC(C)c1ccccc1.
What is the InChIKey of cumene;N'-methylethanimidamide?
The InChIKey is UCYHOCTWVVHIDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C3H8N2/c1-8(2)9-6-4-3-5-7-9;1-3(4)5-2/h3-8H,1-2H3;1-2H3,(H2,4,5).
What are the key properties of cumene;N'-methylethanimidamide?
cumene;N'-methylethanimidamide has a molecular weight of 192.31 g/mol, XLogP of 2.80, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cumene;N'-methylethanimidamide is sourced from PubChem (CID 142863724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).