C15H23LiO3S — CID 155386874
lithium 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 155386874) has the molecular formula C15H23LiO3S and a molecular weight of 290.35 g/mol. Its IUPAC name is lithium 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | lithium 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 155386874 |
| Molecular Formula | C15H23LiO3S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | lithium 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)[O-])c(C(C)C)c1.[Li+] |
| InChI | InChI=1S/C15H24O3S.Li/c1-9(2)12-7-13(10(3)4)15(19(16,17)18)14(8-12)11(5)6;/h7-11H,1-6H3,(H,16,17,18);/q;+1/p-1 |
| InChIKey | GLWVWWPYIMQPCC-UHFFFAOYSA-M |
| XLogP | 0.96 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|