C15H23LiO2S — CID 23661810
lithium 2,4,6-tri(propan-2-yl)benzenesulfinate (PubChem CID 23661810) has the molecular formula C15H23LiO2S and a molecular weight of 274.35 g/mol. Its IUPAC name is lithium 2,4,6-tri(propan-2-yl)benzenesulfinate.
| Compound Name | lithium 2,4,6-tri(propan-2-yl)benzenesulfinate |
|---|---|
| PubChem CID | 23661810 |
| Molecular Formula | C15H23LiO2S |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | lithium 2,4,6-tri(propan-2-yl)benzenesulfinate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)[O-])c(C(C)C)c1.[Li+] |
| InChI | InChI=1S/C15H24O2S.Li/c1-9(2)12-7-13(10(3)4)15(18(16)17)14(8-12)11(5)6;/h7-11H,1-6H3,(H,16,17);/q;+1/p-1 |
| InChIKey | NVBMGOHJUIFNAH-UHFFFAOYSA-M |
| XLogP | 1.30 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|