C16H28O2S — CID 145144506
2-hydroxysulfanyl-1,3,5-tri(propan-2-yl)benzene;methanol (PubChem CID 145144506) has the molecular formula C16H28O2S and a molecular weight of 284.47 g/mol. Its IUPAC name is 2-hydroxysulfanyl-1,3,5-tri(propan-2-yl)benzene;methanol.
| Compound Name | 2-hydroxysulfanyl-1,3,5-tri(propan-2-yl)benzene;methanol |
|---|---|
| PubChem CID | 145144506 |
| Molecular Formula | C16H28O2S |
| Molecular Weight | 284.47 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2-hydroxysulfanyl-1,3,5-tri(propan-2-yl)benzene;methanol |
| SMILES | CC(C)c1cc(C(C)C)c(SO)c(C(C)C)c1.CO |
| InChI | InChI=1S/C15H24OS.CH4O/c1-9(2)12-7-13(10(3)4)15(17-16)14(8-12)11(5)6;1-2/h7-11,16H,1-6H3;2H,1H3 |
| InChIKey | YBAJAXUZYLVCRR-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.47 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|