C18H27BrOS — CID 11383137
S-[2,4,6-tri(propan-2-yl)phenyl] 2-bromopropanethioate (PubChem CID 11383137) has the molecular formula C18H27BrOS and a molecular weight of 371.38 g/mol. Its IUPAC name is S-[2,4,6-tri(propan-2-yl)phenyl] 2-bromopropanethioate.
| Compound Name | S-[2,4,6-tri(propan-2-yl)phenyl] 2-bromopropanethioate |
|---|---|
| PubChem CID | 11383137 |
| Molecular Formula | C18H27BrOS |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | S-[2,4,6-tri(propan-2-yl)phenyl] 2-bromopropanethioate |
| SMILES | CC(Br)C(=O)Sc1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C18H27BrOS/c1-10(2)14-8-15(11(3)4)17(16(9-14)12(5)6)21-18(20)13(7)19/h8-13H,1-7H3 |
| InChIKey | WUWZTTIBDXGOMN-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|