C30H47BO — CID 139174643
bis[2,4,6-tri(propan-2-yl)phenyl]borinic acid (PubChem CID 139174643) has the molecular formula C30H47BO and a molecular weight of 434.52 g/mol. Its IUPAC name is bis[2,4,6-tri(propan-2-yl)phenyl]borinic acid.
| Compound Name | bis[2,4,6-tri(propan-2-yl)phenyl]borinic acid |
|---|---|
| PubChem CID | 139174643 |
| Molecular Formula | C30H47BO |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.37 |
| IUPAC Name | bis[2,4,6-tri(propan-2-yl)phenyl]borinic acid |
| SMILES | CC(C)c1cc(C(C)C)c(B(O)c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C30H47BO/c1-17(2)23-13-25(19(5)6)29(26(14-23)20(7)8)31(32)30-27(21(9)10)15-24(18(3)4)16-28(30)22(11)12/h13-22,32H,1-12H3 |
| InChIKey | FWIGTVRJGPOEAY-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|