About CID 23175245
CID 23175245 (PubChem CID 23175245) has the molecular formula C17H29Si
and a molecular weight of 261.50 g/mol.
Molecular Properties
| Compound Name | CID 23175245 |
| PubChem CID | 23175245 |
| Molecular Formula | C17H29Si |
| Molecular Weight | 261.50 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | — |
| SMILES | CC(C)c1cc(C(C)C)c([Si](C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C17H29Si/c1-11(2)14-9-15(12(3)4)17(18(7)8)16(10-14)13(5)6/h9-13H,1-8H3 |
| InChIKey | JHWLIWCYICHMMM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 261.50 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 23175245 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 23175245?
The IUPAC name of CID 23175245 (CID 23175245) is not available.
What is the SMILES notation for CID 23175245?
The canonical SMILES for CID 23175245 is CC(C)c1cc(C(C)C)c([Si](C)C)c(C(C)C)c1.
What is the InChIKey of CID 23175245?
The InChIKey is JHWLIWCYICHMMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29Si/c1-11(2)14-9-15(12(3)4)17(18(7)8)16(10-14)13(5)6/h9-13H,1-8H3.
What are the key properties of CID 23175245?
CID 23175245 has a molecular weight of 261.50 g/mol, XLogP of 5.02, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 23175245 is sourced from PubChem (CID 23175245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).