C15H23LiTe — CID 134893243
[2,4,6-tri(propan-2-yl)phenyl]tellanyllithium (PubChem CID 134893243) has the molecular formula C15H23LiTe and a molecular weight of 337.89 g/mol. Its IUPAC name is [2,4,6-tri(propan-2-yl)phenyl]tellanyllithium.
| Compound Name | [2,4,6-tri(propan-2-yl)phenyl]tellanyllithium |
|---|---|
| PubChem CID | 134893243 |
| Molecular Formula | C15H23LiTe |
| Molecular Weight | 337.89 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | [2,4,6-tri(propan-2-yl)phenyl]tellanyllithium |
| SMILES | [Li][Te]c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C15H24Te.Li/c1-9(2)12-7-13(10(3)4)15(16)14(8-12)11(5)6;/h7-11,16H,1-6H3;/q;+1/p-1 |
| InChIKey | CKZJULKDGLBQIY-UHFFFAOYSA-M |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.89 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|