C30H48Ge — CID 71343686
bis[2,4,6-tri(propan-2-yl)phenyl]germane (PubChem CID 71343686) has the molecular formula C30H48Ge and a molecular weight of 481.32 g/mol. Its IUPAC name is bis[2,4,6-tri(propan-2-yl)phenyl]germane.
| Compound Name | bis[2,4,6-tri(propan-2-yl)phenyl]germane |
|---|---|
| PubChem CID | 71343686 |
| Molecular Formula | C30H48Ge |
| Molecular Weight | 481.32 g/mol |
| Exact Mass | 482.30 |
| IUPAC Name | bis[2,4,6-tri(propan-2-yl)phenyl]germane |
| SMILES | CC(C)c1cc(C(C)C)c([GeH2]c2c(C(C)C)cc(C(C)C)cc2C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C30H48Ge/c1-17(2)23-13-25(19(5)6)29(26(14-23)20(7)8)31-30-27(21(9)10)15-24(18(3)4)16-28(30)22(11)12/h13-22H,31H2,1-12H3 |
| InChIKey | IPGJVMDIENUKKL-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.32 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |