C15H25P — CID 609106
[2,4,6-tri(propan-2-yl)phenyl]phosphane (PubChem CID 609106) has the molecular formula C15H25P and a molecular weight of 236.34 g/mol. Its IUPAC name is [2,4,6-tri(propan-2-yl)phenyl]phosphane.
| Compound Name | [2,4,6-tri(propan-2-yl)phenyl]phosphane |
|---|---|
| PubChem CID | 609106 |
| Molecular Formula | C15H25P |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | [2,4,6-tri(propan-2-yl)phenyl]phosphane |
| SMILES | CC(C)c1cc(C(C)C)c(P)c(C(C)C)c1 |
| InChI | InChI=1S/C15H25P/c1-9(2)12-7-13(10(3)4)15(16)14(8-12)11(5)6/h7-11H,16H2,1-6H3 |
| InChIKey | RVQREEMFKAYTDD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|