C12H19P — CID 146386628
[2,5-di(propan-2-yl)phenyl]phosphane (PubChem CID 146386628) has the molecular formula C12H19P and a molecular weight of 194.26 g/mol. Its IUPAC name is [2,5-di(propan-2-yl)phenyl]phosphane.
| Compound Name | [2,5-di(propan-2-yl)phenyl]phosphane |
|---|---|
| PubChem CID | 146386628 |
| Molecular Formula | C12H19P |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | [2,5-di(propan-2-yl)phenyl]phosphane |
| SMILES | CC(C)c1ccc(C(C)C)c(P)c1 |
| InChI | InChI=1S/C12H19P/c1-8(2)10-5-6-11(9(3)4)12(13)7-10/h5-9H,13H2,1-4H3 |
| InChIKey | FNINUNLQOAYUQC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|