C21H29P — CID 174843479
[2,4-di(propan-2-yl)-3-(4-propan-2-ylphenyl)phenyl]phosphane (PubChem CID 174843479) has the molecular formula C21H29P and a molecular weight of 312.44 g/mol. Its IUPAC name is [2,4-di(propan-2-yl)-3-(4-propan-2-ylphenyl)phenyl]phosphane.
| Compound Name | [2,4-di(propan-2-yl)-3-(4-propan-2-ylphenyl)phenyl]phosphane |
|---|---|
| PubChem CID | 174843479 |
| Molecular Formula | C21H29P |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | [2,4-di(propan-2-yl)-3-(4-propan-2-ylphenyl)phenyl]phosphane |
| SMILES | CC(C)c1ccc(-c2c(C(C)C)ccc(P)c2C(C)C)cc1 |
| InChI | InChI=1S/C21H29P/c1-13(2)16-7-9-17(10-8-16)21-18(14(3)4)11-12-19(22)20(21)15(5)6/h7-15H,22H2,1-6H3 |
| InChIKey | BHROMHOWZAZNHS-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|