C13H17FO — CID 45081927
2,5-di(propan-2-yl)benzoyl fluoride (PubChem CID 45081927) has the molecular formula C13H17FO and a molecular weight of 208.28 g/mol. Its IUPAC name is 2,5-di(propan-2-yl)benzoyl fluoride.
| Compound Name | 2,5-di(propan-2-yl)benzoyl fluoride |
|---|---|
| PubChem CID | 45081927 |
| Molecular Formula | C13H17FO |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | 2,5-di(propan-2-yl)benzoyl fluoride |
| SMILES | CC(C)c1ccc(C(C)C)c(C(=O)F)c1 |
| InChI | InChI=1S/C13H17FO/c1-8(2)10-5-6-11(9(3)4)12(7-10)13(14)15/h5-9H,1-4H3 |
| InChIKey | XTQGXTXKTHPDKZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|