C14H20F2O — CID 113435253
1-[2,4-di(propan-2-yl)phenyl]-2,2-difluoroethanol (PubChem CID 113435253) has the molecular formula C14H20F2O and a molecular weight of 242.31 g/mol. Its IUPAC name is 1-[2,4-di(propan-2-yl)phenyl]-2,2-difluoroethanol.
| Compound Name | 1-[2,4-di(propan-2-yl)phenyl]-2,2-difluoroethanol |
|---|---|
| PubChem CID | 113435253 |
| Molecular Formula | C14H20F2O |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 1-[2,4-di(propan-2-yl)phenyl]-2,2-difluoroethanol |
| SMILES | CC(C)c1ccc(C(O)C(F)F)c(C(C)C)c1 |
| InChI | InChI=1S/C14H20F2O/c1-8(2)10-5-6-11(13(17)14(15)16)12(7-10)9(3)4/h5-9,13-14,17H,1-4H3 |
| InChIKey | JDNSEQPYYDMSRM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |