C19H32O — CID 114753381
1-[2,4-di(propan-2-yl)phenyl]heptan-1-ol (PubChem CID 114753381) has the molecular formula C19H32O and a molecular weight of 276.46 g/mol. Its IUPAC name is 1-[2,4-di(propan-2-yl)phenyl]heptan-1-ol.
| Compound Name | 1-[2,4-di(propan-2-yl)phenyl]heptan-1-ol |
|---|---|
| PubChem CID | 114753381 |
| Molecular Formula | C19H32O |
| Molecular Weight | 276.46 g/mol |
| Exact Mass | 276.25 |
| IUPAC Name | 1-[2,4-di(propan-2-yl)phenyl]heptan-1-ol |
| SMILES | CCCCCCC(O)c1ccc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C19H32O/c1-6-7-8-9-10-19(20)17-12-11-16(14(2)3)13-18(17)15(4)5/h11-15,19-20H,6-10H2,1-5H3 |
| InChIKey | IKRLCBYLWSOWEQ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.46 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|