C19H31Br — CID 114753582
1-(1-bromoheptyl)-2,4-di(propan-2-yl)benzene (PubChem CID 114753582) has the molecular formula C19H31Br and a molecular weight of 339.36 g/mol. Its IUPAC name is 1-(1-bromoheptyl)-2,4-di(propan-2-yl)benzene.
| Compound Name | 1-(1-bromoheptyl)-2,4-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 114753582 |
| Molecular Formula | C19H31Br |
| Molecular Weight | 339.36 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 1-(1-bromoheptyl)-2,4-di(propan-2-yl)benzene |
| SMILES | CCCCCCC(Br)c1ccc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C19H31Br/c1-6-7-8-9-10-19(20)17-12-11-16(14(2)3)13-18(17)15(4)5/h11-15,19H,6-10H2,1-5H3 |
| InChIKey | LSVXUTBEYFQWTH-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.36 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|