C16H23BrCl2 — CID 65427160
1-(1-bromodecyl)-2,4-dichlorobenzene (PubChem CID 65427160) has the molecular formula C16H23BrCl2 and a molecular weight of 366.17 g/mol. Its IUPAC name is 1-(1-bromodecyl)-2,4-dichlorobenzene.
| Compound Name | 1-(1-bromodecyl)-2,4-dichlorobenzene |
|---|---|
| PubChem CID | 65427160 |
| Molecular Formula | C16H23BrCl2 |
| Molecular Weight | 366.17 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 1-(1-bromodecyl)-2,4-dichlorobenzene |
| SMILES | CCCCCCCCCC(Br)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H23BrCl2/c1-2-3-4-5-6-7-8-9-15(17)14-11-10-13(18)12-16(14)19/h10-12,15H,2-9H2,1H3 |
| InChIKey | GXTYGIQVKNWHCH-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.17 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|