C14H19Cl3 — CID 63436691
1,4-dichloro-2-(1-chlorooctyl)benzene (PubChem CID 63436691) has the molecular formula C14H19Cl3 and a molecular weight of 293.66 g/mol. Its IUPAC name is 1,4-dichloro-2-(1-chlorooctyl)benzene.
| Compound Name | 1,4-dichloro-2-(1-chlorooctyl)benzene |
|---|---|
| PubChem CID | 63436691 |
| Molecular Formula | C14H19Cl3 |
| Molecular Weight | 293.66 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 1,4-dichloro-2-(1-chlorooctyl)benzene |
| SMILES | CCCCCCCC(Cl)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H19Cl3/c1-2-3-4-5-6-7-13(16)12-10-11(15)8-9-14(12)17/h8-10,13H,2-7H2,1H3 |
| InChIKey | YFZUXBDBNRIYOY-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.66 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|