C17H27Cl2N — CID 65449519
1-(2,5-dichlorophenyl)-N-methyldecan-1-amine (PubChem CID 65449519) has the molecular formula C17H27Cl2N and a molecular weight of 316.32 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-N-methyldecan-1-amine.
| Compound Name | 1-(2,5-dichlorophenyl)-N-methyldecan-1-amine |
|---|---|
| PubChem CID | 65449519 |
| Molecular Formula | C17H27Cl2N |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-N-methyldecan-1-amine |
| SMILES | CCCCCCCCCC(NC)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H27Cl2N/c1-3-4-5-6-7-8-9-10-17(20-2)15-13-14(18)11-12-16(15)19/h11-13,17,20H,3-10H2,1-2H3 |
| InChIKey | CDBNVIUTDLFBLB-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|