C16H25Cl2N — CID 65449520
1-(2,5-dichlorophenyl)-N-methylnonan-1-amine (PubChem CID 65449520) has the molecular formula C16H25Cl2N and a molecular weight of 302.29 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-N-methylnonan-1-amine.
| Compound Name | 1-(2,5-dichlorophenyl)-N-methylnonan-1-amine |
|---|---|
| PubChem CID | 65449520 |
| Molecular Formula | C16H25Cl2N |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-N-methylnonan-1-amine |
| SMILES | CCCCCCCCC(NC)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H25Cl2N/c1-3-4-5-6-7-8-9-16(19-2)14-12-13(17)10-11-15(14)18/h10-12,16,19H,3-9H2,1-2H3 |
| InChIKey | FKJXNYPMAGAOLS-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|