C13H17Cl2NO2 — CID 144705770
[(1R)-1-(2,4-dichlorophenyl)hexyl] carbamate (PubChem CID 144705770) has the molecular formula C13H17Cl2NO2 and a molecular weight of 290.19 g/mol. Its IUPAC name is [(1R)-1-(2,4-dichlorophenyl)hexyl] carbamate.
| Compound Name | [(1R)-1-(2,4-dichlorophenyl)hexyl] carbamate |
|---|---|
| PubChem CID | 144705770 |
| Molecular Formula | C13H17Cl2NO2 |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | [(1R)-1-(2,4-dichlorophenyl)hexyl] carbamate |
| SMILES | CCCCC[C@@H](OC(N)=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H17Cl2NO2/c1-2-3-4-5-12(18-13(16)17)10-7-6-9(14)8-11(10)15/h6-8,12H,2-5H2,1H3,(H2,16,17)/t12-/m1/s1 |
| InChIKey | RCDQXGIELLVDOQ-GFCCVEGCSA-N |
| XLogP | 4.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|