About 1-(2-chlorophenyl)pentyl acetate
1-(2-chlorophenyl)pentyl acetate (PubChem CID 141200843) has the molecular formula C13H17ClO2
and a molecular weight of 240.73 g/mol. Its IUPAC name is 1-(2-chlorophenyl)pentyl acetate.
Molecular Properties
| Compound Name | 1-(2-chlorophenyl)pentyl acetate |
| PubChem CID | 141200843 |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 1-(2-chlorophenyl)pentyl acetate |
| SMILES | CCCCC(OC(C)=O)c1ccccc1Cl |
| InChI | InChI=1S/C13H17ClO2/c1-3-4-9-13(16-10(2)15)11-7-5-6-8-12(11)14/h5-8,13H,3-4,9H2,1-2H3 |
| InChIKey | RWAFCQCHWOBKRX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-chlorophenyl)pentyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chlorophenyl)pentyl acetate?
The IUPAC name of 1-(2-chlorophenyl)pentyl acetate (CID 141200843) is 1-(2-chlorophenyl)pentyl acetate.
What is the SMILES notation for 1-(2-chlorophenyl)pentyl acetate?
The canonical SMILES for 1-(2-chlorophenyl)pentyl acetate is CCCCC(OC(C)=O)c1ccccc1Cl.
What is the InChIKey of 1-(2-chlorophenyl)pentyl acetate?
The InChIKey is RWAFCQCHWOBKRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClO2/c1-3-4-9-13(16-10(2)15)11-7-5-6-8-12(11)14/h5-8,13H,3-4,9H2,1-2H3.
What are the key properties of 1-(2-chlorophenyl)pentyl acetate?
1-(2-chlorophenyl)pentyl acetate has a molecular weight of 240.73 g/mol, XLogP of 4.13, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chlorophenyl)pentyl acetate is sourced from PubChem (CID 141200843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).