About [(1S)-1-phenylpentyl] acetate
[(1S)-1-phenylpentyl] acetate (PubChem CID 12651064) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is [(1S)-1-phenylpentyl] acetate.
Molecular Properties
| Compound Name | [(1S)-1-phenylpentyl] acetate |
| PubChem CID | 12651064 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | [(1S)-1-phenylpentyl] acetate |
| SMILES | CCCC[C@H](OC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C13H18O2/c1-3-4-10-13(15-11(2)14)12-8-6-5-7-9-12/h5-9,13H,3-4,10H2,1-2H3/t13-/m0/s1 |
| InChIKey | UNBGLXOZZKYZEN-ZDUSSCGKSA-N |
| XLogP | 3.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1S)-1-phenylpentyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-phenylpentyl] acetate?
The IUPAC name of [(1S)-1-phenylpentyl] acetate (CID 12651064) is [(1S)-1-phenylpentyl] acetate.
What is the SMILES notation for [(1S)-1-phenylpentyl] acetate?
The canonical SMILES for [(1S)-1-phenylpentyl] acetate is CCCC[C@H](OC(C)=O)c1ccccc1.
What is the InChIKey of [(1S)-1-phenylpentyl] acetate?
The InChIKey is UNBGLXOZZKYZEN-ZDUSSCGKSA-N. The full InChI is InChI=1S/C13H18O2/c1-3-4-10-13(15-11(2)14)12-8-6-5-7-9-12/h5-9,13H,3-4,10H2,1-2H3/t13-/m0/s1.
What are the key properties of [(1S)-1-phenylpentyl] acetate?
[(1S)-1-phenylpentyl] acetate has a molecular weight of 206.29 g/mol, XLogP of 3.48, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-phenylpentyl] acetate is sourced from PubChem (CID 12651064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).