C24H28O4 — CID 66559815
[(E)-8-acetyloxy-1,8-diphenyloct-5-enyl] acetate (PubChem CID 66559815) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is [(E)-8-acetyloxy-1,8-diphenyloct-5-enyl] acetate.
| Compound Name | [(E)-8-acetyloxy-1,8-diphenyloct-5-enyl] acetate |
|---|---|
| PubChem CID | 66559815 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [(E)-8-acetyloxy-1,8-diphenyloct-5-enyl] acetate |
| SMILES | CC(=O)OC(C/C=C/CCCC(OC(C)=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28O4/c1-19(25)27-23(21-13-7-5-8-14-21)17-11-3-4-12-18-24(28-20(2)26)22-15-9-6-10-16-22/h3,5-11,13-16,23-24H,4,12,17-18H2,1-2H3/b11-3+ |
| InChIKey | OIXQESJDYWDLPR-QDEBKDIKSA-N |
| XLogP | 5.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|