C23H22O4 — CID 19790806
3-acetyloxy-3-phenylpropanoic acid;1,1'-biphenyl (PubChem CID 19790806) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-acetyloxy-3-phenylpropanoic acid;1,1'-biphenyl.
| Compound Name | 3-acetyloxy-3-phenylpropanoic acid;1,1'-biphenyl |
|---|---|
| PubChem CID | 19790806 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 3-acetyloxy-3-phenylpropanoic acid;1,1'-biphenyl |
| SMILES | CC(=O)OC(CC(=O)O)c1ccccc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C11H12O4/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-8(12)15-10(7-11(13)14)9-5-3-2-4-6-9/h1-10H;2-6,10H,7H2,1H3,(H,13,14) |
| InChIKey | MMCFVQNFPOFSPD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |