C42H78O7Si3 — CID 101438914
methyl (E)-15-acetyloxy-6,9,12-tris[[tert-butyl(dimethyl)silyl]oxy]-15-phenylpentadec-2-enoate (PubChem CID 101438914) has the molecular formula C42H78O7Si3 and a molecular weight of 779.34 g/mol. Its IUPAC name is methyl (E)-15-acetyloxy-6,9,12-tris[[tert-butyl(dimethyl)silyl]oxy]-15-phenylpentadec-2-enoate.
| Compound Name | methyl (E)-15-acetyloxy-6,9,12-tris[[tert-butyl(dimethyl)silyl]oxy]-15-phenylpentadec-2-enoate |
|---|---|
| PubChem CID | 101438914 |
| Molecular Formula | C42H78O7Si3 |
| Molecular Weight | 779.34 g/mol |
| Exact Mass | 778.51 |
| IUPAC Name | methyl (E)-15-acetyloxy-6,9,12-tris[[tert-butyl(dimethyl)silyl]oxy]-15-phenylpentadec-2-enoate |
| SMILES | COC(=O)/C=C/CCC(CCC(CCC(CCC(OC(C)=O)c1ccccc1)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C42H78O7Si3/c1-33(43)46-38(34-23-19-18-20-24-34)32-31-37(49-52(16,17)42(8,9)10)30-29-36(48-51(14,15)41(5,6)7)28-27-35(25-21-22-26-39(44)45-11)47-50(12,13)40(2,3)4/h18-20,22-24,26,35-38H,21,25,27-32H2,1-17H3/b26-22+ |
| InChIKey | DAKGGGTZULTHFP-XTCLZLMSSA-N |
| XLogP | 12.31 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.34 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|