C25H46O3Si2 — CID 11419569
(5R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylheptanal (PubChem CID 11419569) has the molecular formula C25H46O3Si2 and a molecular weight of 450.81 g/mol. Its IUPAC name is (5R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylheptanal.
| Compound Name | (5R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylheptanal |
|---|---|
| PubChem CID | 11419569 |
| Molecular Formula | C25H46O3Si2 |
| Molecular Weight | 450.81 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | (5R,7S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-7-phenylheptanal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](CCCC=O)C[C@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H46O3Si2/c1-24(2,3)29(7,8)27-22(18-14-15-19-26)20-23(21-16-12-11-13-17-21)28-30(9,10)25(4,5)6/h11-13,16-17,19,22-23H,14-15,18,20H2,1-10H3/t22-,23+/m1/s1 |
| InChIKey | OMMJZMDDTCQEJB-PKTZIBPZSA-N |
| XLogP | 7.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.81 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|