C19H32O2Si — CID 101047793
(1R,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-phenylhex-5-en-3-ol (PubChem CID 101047793) has the molecular formula C19H32O2Si and a molecular weight of 320.55 g/mol. Its IUPAC name is (1R,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-phenylhex-5-en-3-ol.
| Compound Name | (1R,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-phenylhex-5-en-3-ol |
|---|---|
| PubChem CID | 101047793 |
| Molecular Formula | C19H32O2Si |
| Molecular Weight | 320.55 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | (1R,3S,4S)-1-[tert-butyl(dimethyl)silyl]oxy-4-methyl-1-phenylhex-5-en-3-ol |
| SMILES | C=C[C@H](C)[C@@H](O)C[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C19H32O2Si/c1-8-15(2)17(20)14-18(16-12-10-9-11-13-16)21-22(6,7)19(3,4)5/h8-13,15,17-18,20H,1,14H2,2-7H3/t15-,17-,18+/m0/s1 |
| InChIKey | XRTIUKCHDHTTQS-RYQLBKOJSA-N |
| XLogP | 5.32 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|