C16H27NOSi — CID 66693822
1-[tert-butyl(dimethyl)silyl]oxy-1-phenylbut-3-en-2-amine (PubChem CID 66693822) has the molecular formula C16H27NOSi and a molecular weight of 277.48 g/mol. Its IUPAC name is 1-[tert-butyl(dimethyl)silyl]oxy-1-phenylbut-3-en-2-amine.
| Compound Name | 1-[tert-butyl(dimethyl)silyl]oxy-1-phenylbut-3-en-2-amine |
|---|---|
| PubChem CID | 66693822 |
| Molecular Formula | C16H27NOSi |
| Molecular Weight | 277.48 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | 1-[tert-butyl(dimethyl)silyl]oxy-1-phenylbut-3-en-2-amine |
| SMILES | C=CC(N)C(O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H27NOSi/c1-7-14(17)15(13-11-9-8-10-12-13)18-19(5,6)16(2,3)4/h7-12,14-15H,1,17H2,2-6H3 |
| InChIKey | PQCAXCTXUCXJSL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|