C17H26OSi — CID 100919695
tert-butyl-dimethyl-[(1R,2E)-1-phenylpenta-2,4-dienoxy]silane (PubChem CID 100919695) has the molecular formula C17H26OSi and a molecular weight of 274.48 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,2E)-1-phenylpenta-2,4-dienoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(1R,2E)-1-phenylpenta-2,4-dienoxy]silane |
|---|---|
| PubChem CID | 100919695 |
| Molecular Formula | C17H26OSi |
| Molecular Weight | 274.48 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,2E)-1-phenylpenta-2,4-dienoxy]silane |
| SMILES | C=C/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H26OSi/c1-7-8-14-16(15-12-10-9-11-13-15)18-19(5,6)17(2,3)4/h7-14,16H,1H2,2-6H3/b14-8+/t16-/m1/s1 |
| InChIKey | PLHGKFLCUQYRCH-FCONWMNKSA-N |
| XLogP | 5.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.48 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|