C16H27O2PSi — CID 101227507
tert-butyl-[(1R)-1-[ethenyl(phenyl)phosphoryl]ethoxy]-dimethylsilane (PubChem CID 101227507) has the molecular formula C16H27O2PSi and a molecular weight of 310.45 g/mol. Its IUPAC name is tert-butyl-[(1R)-1-[ethenyl(phenyl)phosphoryl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1R)-1-[ethenyl(phenyl)phosphoryl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 101227507 |
| Molecular Formula | C16H27O2PSi |
| Molecular Weight | 310.45 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | tert-butyl-[(1R)-1-[ethenyl(phenyl)phosphoryl]ethoxy]-dimethylsilane |
| SMILES | C=CP(=O)(c1ccccc1)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H27O2PSi/c1-8-19(17,15-12-10-9-11-13-15)14(2)18-20(6,7)16(3,4)5/h8-14H,1H2,2-7H3/t14-,19?/m1/s1 |
| InChIKey | SHPBZBUSYWNEEH-MJTSIZKDSA-N |
| XLogP | 5.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.45 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|