C32H51O3PSi2 — CID 71148978
tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylidene-2-diphenylphosphorylethoxy]-dimethylsilane (PubChem CID 71148978) has the molecular formula C32H51O3PSi2 and a molecular weight of 570.90 g/mol. Its IUPAC name is tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylidene-2-diphenylphosphorylethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylidene-2-diphenylphosphorylethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 71148978 |
| Molecular Formula | C32H51O3PSi2 |
| Molecular Weight | 570.90 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | tert-butyl-[1-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexylidene-2-diphenylphosphorylethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OC(O[Si](C)(C)C(C)(C)C)C(=C1CCCCC1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H51O3PSi2/c1-31(2,3)37(7,8)34-30(35-38(9,10)32(4,5)6)29(26-20-14-11-15-21-26)36(33,27-22-16-12-17-23-27)28-24-18-13-19-25-28/h12-13,16-19,22-25,30H,11,14-15,20-21H2,1-10H3 |
| InChIKey | JDRRQBXXEUQEJC-UHFFFAOYSA-N |
| XLogP | 9.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.90 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|