C18H26O3Si — CID 102079562
(3E)-3-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethylidene]oxolan-2-one (PubChem CID 102079562) has the molecular formula C18H26O3Si and a molecular weight of 318.49 g/mol. Its IUPAC name is (3E)-3-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethylidene]oxolan-2-one.
| Compound Name | (3E)-3-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethylidene]oxolan-2-one |
|---|---|
| PubChem CID | 102079562 |
| Molecular Formula | C18H26O3Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (3E)-3-[2-[tert-butyl(dimethyl)silyl]oxy-2-phenylethylidene]oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC(/C=C1\CCOC1=O)c1ccccc1 |
| InChI | InChI=1S/C18H26O3Si/c1-18(2,3)22(4,5)21-16(14-9-7-6-8-10-14)13-15-11-12-20-17(15)19/h6-10,13,16H,11-12H2,1-5H3/b15-13+ |
| InChIKey | JUFLAAZTWQZZIL-FYWRMAATSA-N |
| XLogP | 4.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|